C14H9ClFN3 — CID 725409
N-(3-chloro-4-fluorophenyl)quinazolin-4-amine (PubChem CID 725409) has the molecular formula C14H9ClFN3 and a molecular weight of 273.70 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 725409 |
| Molecular Formula | C14H9ClFN3 |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)quinazolin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3ccccc23)cc1Cl |
| InChI | InChI=1S/C14H9ClFN3/c15-11-7-9(5-6-12(11)16)19-14-10-3-1-2-4-13(10)17-8-18-14/h1-8H,(H,17,18,19) |
| InChIKey | ODUHDKRYKFSJAH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |