C14H8Cl3FN4O2 — CID 23373693
7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine;hydrochloride (PubChem CID 23373693) has the molecular formula C14H8Cl3FN4O2 and a molecular weight of 389.60 g/mol. Its IUPAC name is 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine;hydrochloride.
| Compound Name | 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 23373693 |
| Molecular Formula | C14H8Cl3FN4O2 |
| Molecular Weight | 389.60 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1Cl |
| InChI | InChI=1S/C14H7Cl2FN4O2.ClH/c15-9-3-7(1-2-11(9)17)20-14-8-4-13(21(22)23)10(16)5-12(8)18-6-19-14;/h1-6H,(H,18,19,20);1H |
| InChIKey | MKQIPDZZARECCC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|