C18H13ClF4N4O4 — CID 118900283
N-(3-chloro-4-fluorophenyl)-6-nitro-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-4-amine (PubChem CID 118900283) has the molecular formula C18H13ClF4N4O4 and a molecular weight of 460.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-nitro-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-nitro-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 118900283 |
| Molecular Formula | C18H13ClF4N4O4 |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-nitro-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C18H13ClF4N4O4/c19-12-5-10(1-2-13(12)20)26-17-11-6-15(27(28)29)16(7-14(11)24-9-25-17)31-4-3-30-8-18(21,22)23/h1-2,5-7,9H,3-4,8H2,(H,24,25,26) |
| InChIKey | GAIMTVIFHUJCQM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|