C24H24ClF4N5O3 — CID 118900255
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 118900255) has the molecular formula C24H24ClF4N5O3 and a molecular weight of 541.93 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 118900255 |
| Molecular Formula | C24H24ClF4N5O3 |
| Molecular Weight | 541.93 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(2,2,2-trifluoroethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C24H24ClF4N5O3/c1-34(2)7-3-4-22(35)33-20-11-16-19(12-21(20)37-9-8-36-13-24(27,28)29)30-14-31-23(16)32-15-5-6-18(26)17(25)10-15/h3-6,10-12,14H,7-9,13H2,1-2H3,(H,33,35)(H,30,31,32)/b4-3+ |
| InChIKey | BILBHUNTGZHBHP-ONEGZZNKSA-N |
| XLogP | 5.18 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.93 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|