C23H23ClF3N5O3 — CID 130205525
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 130205525) has the molecular formula C23H23ClF3N5O3 and a molecular weight of 509.92 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 130205525 |
| Molecular Formula | C23H23ClF3N5O3 |
| Molecular Weight | 509.92 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCOC(F)F |
| InChI | InChI=1S/C23H23ClF3N5O3/c1-32(2)7-3-4-21(33)31-19-11-15-18(12-20(19)34-8-9-35-23(26)27)28-13-29-22(15)30-14-5-6-17(25)16(24)10-14/h3-6,10-13,23H,7-9H2,1-2H3,(H,31,33)(H,28,29,30)/b4-3+ |
| InChIKey | UCNRKLQQVFEGOV-ONEGZZNKSA-N |
| XLogP | 4.84 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|