C25H24F3N5O3 — CID 130205532
(E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 130205532) has the molecular formula C25H24F3N5O3 and a molecular weight of 499.49 g/mol. Its IUPAC name is (E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 130205532 |
| Molecular Formula | C25H24F3N5O3 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC(F)F)c(NC(=O)/C=C/CN(C)C)cc23)c1F |
| InChI | InChI=1S/C25H24F3N5O3/c1-4-16-7-5-8-18(23(16)26)32-24-17-13-20(31-22(34)9-6-10-33(2)3)21(14-19(17)29-15-30-24)35-11-12-36-25(27)28/h1,5-9,13-15,25H,10-12H2,2-3H3,(H,31,34)(H,29,30,32)/b9-6+ |
| InChIKey | XDVYZRKFMIYDOA-RMKNXTFCSA-N |
| XLogP | 4.17 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|