C18H16ClF3N4O3 — CID 145347225
4-N-(3-chloro-2-fluorophenyl)-7-[2-(difluoromethoxy)ethoxy]-6-N-methoxyquinazoline-4,6-diamine (PubChem CID 145347225) has the molecular formula C18H16ClF3N4O3 and a molecular weight of 428.80 g/mol. Its IUPAC name is 4-N-(3-chloro-2-fluorophenyl)-7-[2-(difluoromethoxy)ethoxy]-6-N-methoxyquinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-2-fluorophenyl)-7-[2-(difluoromethoxy)ethoxy]-6-N-methoxyquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 145347225 |
| Molecular Formula | C18H16ClF3N4O3 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-N-(3-chloro-2-fluorophenyl)-7-[2-(difluoromethoxy)ethoxy]-6-N-methoxyquinazoline-4,6-diamine |
| SMILES | CONc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1OCCOC(F)F |
| InChI | InChI=1S/C18H16ClF3N4O3/c1-27-26-14-7-10-13(8-15(14)28-5-6-29-18(21)22)23-9-24-17(10)25-12-4-2-3-11(19)16(12)20/h2-4,7-9,18,26H,5-6H2,1H3,(H,23,24,25) |
| InChIKey | YLLPRCAZZCRXTF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|