C23H27ClFN3O2 — CID 143282534
N-(3-chloro-2-fluorophenyl)-7-methoxy-6-octan-4-yloxyquinazolin-4-amine (PubChem CID 143282534) has the molecular formula C23H27ClFN3O2 and a molecular weight of 431.94 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-7-methoxy-6-octan-4-yloxyquinazolin-4-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)-7-methoxy-6-octan-4-yloxyquinazolin-4-amine |
|---|---|
| PubChem CID | 143282534 |
| Molecular Formula | C23H27ClFN3O2 |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-7-methoxy-6-octan-4-yloxyquinazolin-4-amine |
| SMILES | CCCCC(CCC)Oc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1OC |
| InChI | InChI=1S/C23H27ClFN3O2/c1-4-6-9-15(8-5-2)30-21-12-16-19(13-20(21)29-3)26-14-27-23(16)28-18-11-7-10-17(24)22(18)25/h7,10-15H,4-6,8-9H2,1-3H3,(H,26,27,28) |
| InChIKey | OAQZUQSKJQUPSI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |