C27H35ClFN5O4 — CID 143021863
4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-(4-ethoxybutyl)-5-(methylamino)pentanamide (PubChem CID 143021863) has the molecular formula C27H35ClFN5O4 and a molecular weight of 548.06 g/mol. Its IUPAC name is 4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-(4-ethoxybutyl)-5-(methylamino)pentanamide.
| Compound Name | 4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-(4-ethoxybutyl)-5-(methylamino)pentanamide |
|---|---|
| PubChem CID | 143021863 |
| Molecular Formula | C27H35ClFN5O4 |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-(4-ethoxybutyl)-5-(methylamino)pentanamide |
| SMILES | CCOCCCCNC(=O)CCC(CNC)Oc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1OC |
| InChI | InChI=1S/C27H35ClFN5O4/c1-4-37-13-6-5-12-31-25(35)11-10-18(16-30-2)38-24-14-19-22(15-23(24)36-3)32-17-33-27(19)34-21-9-7-8-20(28)26(21)29/h7-9,14-15,17-18,30H,4-6,10-13,16H2,1-3H3,(H,31,35)(H,32,33,34) |
| InChIKey | RMWPLIRUDNRJMH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|