C18H18Cl2FN3O — CID 143086548
N-(3-chloro-2-fluorophenyl)-6-(chloromethyl)-7-methoxyquinazolin-4-amine;ethane (PubChem CID 143086548) has the molecular formula C18H18Cl2FN3O and a molecular weight of 382.27 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-6-(chloromethyl)-7-methoxyquinazolin-4-amine;ethane.
| Compound Name | N-(3-chloro-2-fluorophenyl)-6-(chloromethyl)-7-methoxyquinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 143086548 |
| Molecular Formula | C18H18Cl2FN3O |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-6-(chloromethyl)-7-methoxyquinazolin-4-amine;ethane |
| SMILES | CC.COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1CCl |
| InChI | InChI=1S/C16H12Cl2FN3O.C2H6/c1-23-14-6-13-10(5-9(14)7-17)16(21-8-20-13)22-12-4-2-3-11(18)15(12)19;1-2/h2-6,8H,7H2,1H3,(H,20,21,22);1-2H3 |
| InChIKey | LEYWVULXXJUCSU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|