C17H16ClFN4O2 — CID 142692093
4-N-(3-chloro-2-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine (PubChem CID 142692093) has the molecular formula C17H16ClFN4O2 and a molecular weight of 362.79 g/mol. Its IUPAC name is 4-N-(3-chloro-2-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-2-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 142692093 |
| Molecular Formula | C17H16ClFN4O2 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-N-(3-chloro-2-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine |
| SMILES | COCCOc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1N |
| InChI | InChI=1S/C17H16ClFN4O2/c1-24-5-6-25-15-8-14-10(7-12(15)20)17(22-9-21-14)23-13-4-2-3-11(18)16(13)19/h2-4,7-9H,5-6,20H2,1H3,(H,21,22,23) |
| InChIKey | ROKKWXGJNDMMGE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|