C15H12Cl3FN4O — CID 174765218
4-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazoline-4,6-diamine;hydrochloride (PubChem CID 174765218) has the molecular formula C15H12Cl3FN4O and a molecular weight of 389.65 g/mol. Its IUPAC name is 4-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazoline-4,6-diamine;hydrochloride.
| Compound Name | 4-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazoline-4,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 174765218 |
| Molecular Formula | C15H12Cl3FN4O |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 4-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazoline-4,6-diamine;hydrochloride |
| SMILES | COc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2cc1N.Cl |
| InChI | InChI=1S/C15H11Cl2FN4O.ClH/c1-23-12-5-11-7(4-9(12)19)15(21-6-20-11)22-10-3-2-8(16)13(17)14(10)18;/h2-6H,19H2,1H3,(H,20,21,22);1H |
| InChIKey | WWIKYZZRBZTZLF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|