C24H23Cl2FN4O4 — CID 86604092
[4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 86604092) has the molecular formula C24H23Cl2FN4O4 and a molecular weight of 521.38 g/mol. Its IUPAC name is [4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | [4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 86604092 |
| Molecular Formula | C24H23Cl2FN4O4 |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | [4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1OCOC(=O)N1CC2CCCC2C1 |
| InChI | InChI=1S/C24H23Cl2FN4O4/c1-33-19-7-15-18(28-11-29-23(15)30-17-6-5-16(25)21(26)22(17)27)8-20(19)34-12-35-24(32)31-9-13-3-2-4-14(13)10-31/h5-8,11,13-14H,2-4,9-10,12H2,1H3,(H,28,29,30) |
| InChIKey | AFQWLCZALRBUBT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|