C22H19Cl2FN4O2 — CID 167487871
1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 167487871) has the molecular formula C22H19Cl2FN4O2 and a molecular weight of 461.32 g/mol. Its IUPAC name is 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167487871 |
| Molecular Formula | C22H19Cl2FN4O2 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC)C1 |
| InChI | InChI=1S/C22H19Cl2FN4O2/c1-3-19(30)29-7-6-12(10-29)13-8-14-17(9-18(13)31-2)26-11-27-22(14)28-16-5-4-15(23)20(24)21(16)25/h3-5,8-9,11-12H,1,6-7,10H2,2H3,(H,26,27,28) |
| InChIKey | HTSCWDGVWLDUDI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|