C21H16Cl2F2N4O5 — CID 167487742
1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(trihydroxymethoxy)quinazolin-6-yl]azetidin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 167487742) has the molecular formula C21H16Cl2F2N4O5 and a molecular weight of 513.28 g/mol. Its IUPAC name is 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(trihydroxymethoxy)quinazolin-6-yl]azetidin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(trihydroxymethoxy)quinazolin-6-yl]azetidin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 167487742 |
| Molecular Formula | C21H16Cl2F2N4O5 |
| Molecular Weight | 513.28 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(trihydroxymethoxy)quinazolin-6-yl]azetidin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CC(c2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC(O)(O)O)C1 |
| InChI | InChI=1S/C21H16Cl2F2N4O5/c1-9(24)20(30)29-6-10(7-29)11-4-12-15(5-16(11)34-21(31,32)33)26-8-27-19(12)28-14-3-2-13(22)17(23)18(14)25/h2-5,8,10,31-33H,1,6-7H2,(H,26,27,28) |
| InChIKey | RVEKPENIKYRZDR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|