C26H23Cl2FN4O4 — CID 155267527
1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxetan-3-yloxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one (PubChem CID 155267527) has the molecular formula C26H23Cl2FN4O4 and a molecular weight of 545.40 g/mol. Its IUPAC name is 1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxetan-3-yloxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxetan-3-yloxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155267527 |
| Molecular Formula | C26H23Cl2FN4O4 |
| Molecular Weight | 545.40 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxetan-3-yloxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2CC(C1)C2Oc1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1OC1COC1 |
| InChI | InChI=1S/C26H23Cl2FN4O4/c1-2-22(34)33-8-13-5-14(9-33)25(13)37-20-6-16-19(7-21(20)36-15-10-35-11-15)30-12-31-26(16)32-18-4-3-17(27)23(28)24(18)29/h2-4,6-7,12-15,25H,1,5,8-11H2,(H,30,31,32) |
| InChIKey | SUXBMFFLLUSXOX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|