C23H21Cl3F2N4O3 — CID 162325377
1-[(3R,4S)-4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-3-fluoropiperidin-1-yl]prop-2-en-1-one;hydrochloride (PubChem CID 162325377) has the molecular formula C23H21Cl3F2N4O3 and a molecular weight of 545.80 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-3-fluoropiperidin-1-yl]prop-2-en-1-one;hydrochloride.
| Compound Name | 1-[(3R,4S)-4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-3-fluoropiperidin-1-yl]prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 162325377 |
| Molecular Formula | C23H21Cl3F2N4O3 |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 1-[(3R,4S)-4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-3-fluoropiperidin-1-yl]prop-2-en-1-one;hydrochloride |
| SMILES | C=CC(=O)N1CC[C@H](Oc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC)[C@H](F)C1.Cl |
| InChI | InChI=1S/C23H20Cl2F2N4O3.ClH/c1-3-20(32)31-7-6-17(14(26)10-31)34-19-8-12-16(9-18(19)33-2)28-11-29-23(12)30-15-5-4-13(24)21(25)22(15)27;/h3-5,8-9,11,14,17H,1,6-7,10H2,2H3,(H,28,29,30);1H/t14-,17+;/m1./s1 |
| InChIKey | YBHHUYBWMNVTOB-CVLQQERVSA-N |
| XLogP | 5.75 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|