C23H22Cl2N4O3 — CID 25128361
1-[4-[4-(3,4-dichloroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 25128361) has the molecular formula C23H22Cl2N4O3 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-[4-[4-(3,4-dichloroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(3,4-dichloroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 25128361 |
| Molecular Formula | C23H22Cl2N4O3 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-[4-[4-(3,4-dichloroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4ccc(Cl)c(Cl)c4)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C23H22Cl2N4O3/c1-3-22(30)29-8-6-15(7-9-29)32-21-11-16-19(12-20(21)31-2)26-13-27-23(16)28-14-4-5-17(24)18(25)10-14/h3-5,10-13,15H,1,6-9H2,2H3,(H,26,27,28) |
| InChIKey | ZTQLMGBKQNFQRU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|