C28H26ClN5O4 — CID 155748259
1-[4-[4-(3-chloro-4-pyridin-4-yloxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 155748259) has the molecular formula C28H26ClN5O4 and a molecular weight of 532.00 g/mol. Its IUPAC name is 1-[4-[4-(3-chloro-4-pyridin-4-yloxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(3-chloro-4-pyridin-4-yloxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155748259 |
| Molecular Formula | C28H26ClN5O4 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 1-[4-[4-(3-chloro-4-pyridin-4-yloxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4ccc(Oc5ccncc5)c(Cl)c4)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C28H26ClN5O4/c1-3-27(35)34-12-8-20(9-13-34)38-26-15-21-23(16-25(26)36-2)31-17-32-28(21)33-18-4-5-24(22(29)14-18)37-19-6-10-30-11-7-19/h3-7,10-11,14-17,20H,1,8-9,12-13H2,2H3,(H,31,32,33) |
| InChIKey | DZDXWCRDDXRSSL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|