C23H23ClN4O4 — CID 25123749
1-[4-[4-(3-chloro-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 25123749) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is 1-[4-[4-(3-chloro-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(3-chloro-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 25123749 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-[4-[4-(3-chloro-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4ccc(O)c(Cl)c4)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C23H23ClN4O4/c1-3-22(30)28-8-6-15(7-9-28)32-21-11-16-18(12-20(21)31-2)25-13-26-23(16)27-14-4-5-19(29)17(24)10-14/h3-5,10-13,15,29H,1,6-9H2,2H3,(H,25,26,27) |
| InChIKey | DZUAVMPQIAPXAF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|