C24H22ClF3N4O3 — CID 152812807
1-[4-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 152812807) has the molecular formula C24H22ClF3N4O3 and a molecular weight of 506.91 g/mol. Its IUPAC name is 1-[4-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 152812807 |
| Molecular Formula | C24H22ClF3N4O3 |
| Molecular Weight | 506.91 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-[4-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4ccc(Cl)c(C(F)(F)F)c4)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C24H22ClF3N4O3/c1-3-22(33)32-8-6-15(7-9-32)35-21-11-16-19(12-20(21)34-2)29-13-30-23(16)31-14-4-5-18(25)17(10-14)24(26,27)28/h3-5,10-13,15H,1,6-9H2,2H3,(H,29,30,31) |
| InChIKey | SRRMRNDJBCOVBB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.91 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|