C22H20Cl2FN5O2 — CID 166538680
1-[(3S)-3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxypyrido[3,2-d]pyrimidin-6-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166538680) has the molecular formula C22H20Cl2FN5O2 and a molecular weight of 476.34 g/mol. Its IUPAC name is 1-[(3S)-3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxypyrido[3,2-d]pyrimidin-6-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxypyrido[3,2-d]pyrimidin-6-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166538680 |
| Molecular Formula | C22H20Cl2FN5O2 |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1-[(3S)-3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxypyrido[3,2-d]pyrimidin-6-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H](c2nc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC)C1 |
| InChI | InChI=1S/C22H20Cl2FN5O2/c1-3-17(31)30-8-4-5-12(10-30)20-16(32-2)9-15-21(29-20)22(27-11-26-15)28-14-7-6-13(23)18(24)19(14)25/h3,6-7,9,11-12H,1,4-5,8,10H2,2H3,(H,26,27,28)/t12-/m0/s1 |
| InChIKey | GMHYGQUFFSOOMH-LBPRGKRZSA-N |
| XLogP | 5.11 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|