C23H21ClFN5O3 — CID 24883288
(2S)-N-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 24883288) has the molecular formula C23H21ClFN5O3 and a molecular weight of 469.90 g/mol. Its IUPAC name is (2S)-N-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24883288 |
| Molecular Formula | C23H21ClFN5O3 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (2S)-N-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@H]1C(=O)Nc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1OC |
| InChI | InChI=1S/C23H21ClFN5O3/c1-3-20(31)30-9-5-8-18(30)23(32)29-17-10-13-16(11-19(17)33-2)26-12-27-22(13)28-15-7-4-6-14(24)21(15)25/h3-4,6-7,10-12,18H,1,5,8-9H2,2H3,(H,29,32)(H,26,27,28)/t18-/m0/s1 |
| InChIKey | RRFIUDXFIAHHOI-SFHVURJKSA-N |
| XLogP | 4.29 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|