C22H23ClFN5O3 — CID 69194881
(2S)-N-[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]pyrrolidine-2-carboxamide (PubChem CID 69194881) has the molecular formula C22H23ClFN5O3 and a molecular weight of 459.91 g/mol. Its IUPAC name is (2S)-N-[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69194881 |
| Molecular Formula | C22H23ClFN5O3 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (2S)-N-[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]pyrrolidine-2-carboxamide |
| SMILES | COCCOc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C22H23ClFN5O3/c1-31-8-9-32-19-11-17-13(10-18(19)29-22(30)16-6-3-7-25-16)21(27-12-26-17)28-15-5-2-4-14(23)20(15)24/h2,4-5,10-12,16,25H,3,6-9H2,1H3,(H,29,30)(H,26,27,28)/t16-/m0/s1 |
| InChIKey | YJWNRKGQSAAYQE-INIZCTEOSA-N |
| XLogP | 3.88 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|