C21H17BrClF3N4O3 — CID 130205671
(E)-4-bromo-N-[4-(3-chloro-2-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]but-2-enamide (PubChem CID 130205671) has the molecular formula C21H17BrClF3N4O3 and a molecular weight of 545.74 g/mol. Its IUPAC name is (E)-4-bromo-N-[4-(3-chloro-2-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-bromo-N-[4-(3-chloro-2-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 130205671 |
| Molecular Formula | C21H17BrClF3N4O3 |
| Molecular Weight | 545.74 g/mol |
| Exact Mass | 544.01 |
| IUPAC Name | (E)-4-bromo-N-[4-(3-chloro-2-fluoroanilino)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]but-2-enamide |
| SMILES | O=C(/C=C/CBr)Nc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1OCCOC(F)F |
| InChI | InChI=1S/C21H17BrClF3N4O3/c22-6-2-5-18(31)29-16-9-12-15(10-17(16)32-7-8-33-21(25)26)27-11-28-20(12)30-14-4-1-3-13(23)19(14)24/h1-5,9-11,21H,6-8H2,(H,29,31)(H,27,28,30)/b5-2+ |
| InChIKey | JYCBNZWLLOLHGV-GORDUTHDSA-N |
| XLogP | 5.67 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|