C24H26BrFN4O3 — CID 145347200
(E)-4-bromo-N-[4-(2-fluoro-3-methylanilino)-7-(2-propan-2-yloxyethoxy)quinazolin-6-yl]but-2-enamide (PubChem CID 145347200) has the molecular formula C24H26BrFN4O3 and a molecular weight of 517.40 g/mol. Its IUPAC name is (E)-4-bromo-N-[4-(2-fluoro-3-methylanilino)-7-(2-propan-2-yloxyethoxy)quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-bromo-N-[4-(2-fluoro-3-methylanilino)-7-(2-propan-2-yloxyethoxy)quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 145347200 |
| Molecular Formula | C24H26BrFN4O3 |
| Molecular Weight | 517.40 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | (E)-4-bromo-N-[4-(2-fluoro-3-methylanilino)-7-(2-propan-2-yloxyethoxy)quinazolin-6-yl]but-2-enamide |
| SMILES | Cc1cccc(Nc2ncnc3cc(OCCOC(C)C)c(NC(=O)/C=C/CBr)cc23)c1F |
| InChI | InChI=1S/C24H26BrFN4O3/c1-15(2)32-10-11-33-21-13-19-17(12-20(21)29-22(31)8-5-9-25)24(28-14-27-19)30-18-7-4-6-16(3)23(18)26/h4-8,12-15H,9-11H2,1-3H3,(H,29,31)(H,27,28,30)/b8-5+ |
| InChIKey | SKGLUQHHJISTHT-VMPITWQZSA-N |
| XLogP | 5.51 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|