C20H18BrFN4O3 — CID 16679053
N-[4-(4-bromo-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]prop-2-enamide (PubChem CID 16679053) has the molecular formula C20H18BrFN4O3 and a molecular weight of 461.29 g/mol. Its IUPAC name is N-[4-(4-bromo-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(4-bromo-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 16679053 |
| Molecular Formula | C20H18BrFN4O3 |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N-[4-(4-bromo-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCCOC |
| InChI | InChI=1S/C20H18BrFN4O3/c1-3-19(27)25-17-9-13-16(10-18(17)29-7-6-28-2)23-11-24-20(13)26-15-5-4-12(21)8-14(15)22/h3-5,8-11H,1,6-7H2,2H3,(H,25,27)(H,23,24,26) |
| InChIKey | UJQBDJHFABZCBZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|