C22H18BrF4N5O3 — CID 16678755
N-[4-(4-bromo-2-fluoroanilino)-7-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinazolin-6-yl]prop-2-enamide (PubChem CID 16678755) has the molecular formula C22H18BrF4N5O3 and a molecular weight of 556.31 g/mol. Its IUPAC name is N-[4-(4-bromo-2-fluoroanilino)-7-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(4-bromo-2-fluoroanilino)-7-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 16678755 |
| Molecular Formula | C22H18BrF4N5O3 |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | N-[4-(4-bromo-2-fluoroanilino)-7-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H18BrF4N5O3/c1-2-19(33)31-17-9-13-16(10-18(17)35-7-3-6-28-21(34)22(25,26)27)29-11-30-20(13)32-15-5-4-12(23)8-14(15)24/h2,4-5,8-11H,1,3,6-7H2,(H,28,34)(H,31,33)(H,29,30,32) |
| InChIKey | RVHJFVOVALAVIJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|