C27H30BrFN6O5 — CID 91087566
tert-butyl N-[2-[2-[4-(4-bromo-2-fluoroanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-N-methylcarbamate (PubChem CID 91087566) has the molecular formula C27H30BrFN6O5 and a molecular weight of 617.48 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-(4-bromo-2-fluoroanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[4-(4-bromo-2-fluoroanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91087566 |
| Molecular Formula | C27H30BrFN6O5 |
| Molecular Weight | 617.48 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | tert-butyl N-[2-[2-[4-(4-bromo-2-fluoroanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-N-methylcarbamate |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCCNC(=O)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H30BrFN6O5/c1-6-23(36)33-21-12-17-20(31-15-32-25(17)34-19-8-7-16(28)11-18(19)29)13-22(21)39-10-9-30-24(37)14-35(5)26(38)40-27(2,3)4/h6-8,11-13,15H,1,9-10,14H2,2-5H3,(H,30,37)(H,33,36)(H,31,32,34) |
| InChIKey | WRWFUZIMWGVNJA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|