C20H20BrFN6O4 — CID 69100810
[2-[2-[6-amino-4-(4-bromo-2-fluoroanilino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-methylcarbamic acid (PubChem CID 69100810) has the molecular formula C20H20BrFN6O4 and a molecular weight of 507.32 g/mol. Its IUPAC name is [2-[2-[6-amino-4-(4-bromo-2-fluoroanilino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-methylcarbamic acid.
| Compound Name | [2-[2-[6-amino-4-(4-bromo-2-fluoroanilino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 69100810 |
| Molecular Formula | C20H20BrFN6O4 |
| Molecular Weight | 507.32 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | [2-[2-[6-amino-4-(4-bromo-2-fluoroanilino)quinazolin-7-yl]oxyethylamino]-2-oxoethyl]-methylcarbamic acid |
| SMILES | CN(CC(=O)NCCOc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1N)C(=O)O |
| InChI | InChI=1S/C20H20BrFN6O4/c1-28(20(30)31)9-18(29)24-4-5-32-17-8-16-12(7-14(17)23)19(26-10-25-16)27-15-3-2-11(21)6-13(15)22/h2-3,6-8,10H,4-5,9,23H2,1H3,(H,24,29)(H,30,31)(H,25,26,27) |
| InChIKey | KNIKHAUILXLEAQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|