C16H15BrFN5O — CID 69100345
7-(2-aminoethoxy)-4-N-(4-bromo-2-fluorophenyl)quinazoline-4,6-diamine (PubChem CID 69100345) has the molecular formula C16H15BrFN5O and a molecular weight of 392.23 g/mol. Its IUPAC name is 7-(2-aminoethoxy)-4-N-(4-bromo-2-fluorophenyl)quinazoline-4,6-diamine.
| Compound Name | 7-(2-aminoethoxy)-4-N-(4-bromo-2-fluorophenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 69100345 |
| Molecular Formula | C16H15BrFN5O |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 7-(2-aminoethoxy)-4-N-(4-bromo-2-fluorophenyl)quinazoline-4,6-diamine |
| SMILES | NCCOc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1N |
| InChI | InChI=1S/C16H15BrFN5O/c17-9-1-2-13(11(18)5-9)23-16-10-6-12(20)15(24-4-3-19)7-14(10)21-8-22-16/h1-2,5-8H,3-4,19-20H2,(H,21,22,23) |
| InChIKey | AGCQBYHPGADZOE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|