C22H28BrFN4O2 — CID 157222571
N-(4-bromo-2-fluorophenyl)-7-butoxy-6-methoxyquinazolin-4-amine;N,N-dimethylmethanamine (PubChem CID 157222571) has the molecular formula C22H28BrFN4O2 and a molecular weight of 479.39 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-7-butoxy-6-methoxyquinazolin-4-amine;N,N-dimethylmethanamine.
| Compound Name | N-(4-bromo-2-fluorophenyl)-7-butoxy-6-methoxyquinazolin-4-amine;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 157222571 |
| Molecular Formula | C22H28BrFN4O2 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-7-butoxy-6-methoxyquinazolin-4-amine;N,N-dimethylmethanamine |
| SMILES | CCCCOc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1OC.CN(C)C |
| InChI | InChI=1S/C19H19BrFN3O2.C3H9N/c1-3-4-7-26-18-10-16-13(9-17(18)25-2)19(23-11-22-16)24-15-6-5-12(20)8-14(15)21;1-4(2)3/h5-6,8-11H,3-4,7H2,1-2H3,(H,22,23,24);1-3H3 |
| InChIKey | ATDWXXGSQHGSJH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|