C24H26BrFN4O4 — CID 71573031
6-[3-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 71573031) has the molecular formula C24H26BrFN4O4 and a molecular weight of 533.40 g/mol. Its IUPAC name is 6-[3-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[3-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 71573031 |
| Molecular Formula | C24H26BrFN4O4 |
| Molecular Weight | 533.40 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 6-[3-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1OCCCN1CC2OCCOC2C1 |
| InChI | InChI=1S/C24H26BrFN4O4/c1-31-20-11-19-16(24(28-14-27-19)29-18-4-3-15(25)9-17(18)26)10-21(20)32-6-2-5-30-12-22-23(13-30)34-8-7-33-22/h3-4,9-11,14,22-23H,2,5-8,12-13H2,1H3,(H,27,28,29) |
| InChIKey | IFLSSVHOXNQAMF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|