C24H27BrFN5O2 — CID 71573152
6-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 71573152) has the molecular formula C24H27BrFN5O2 and a molecular weight of 516.42 g/mol. Its IUPAC name is 6-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 71573152 |
| Molecular Formula | C24H27BrFN5O2 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 6-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1OCCCN1CC2CNCC2C1 |
| InChI | InChI=1S/C24H27BrFN5O2/c1-32-22-9-21-18(24(29-14-28-21)30-20-4-3-17(25)7-19(20)26)8-23(22)33-6-2-5-31-12-15-10-27-11-16(15)13-31/h3-4,7-9,14-16,27H,2,5-6,10-13H2,1H3,(H,28,29,30) |
| InChIKey | SRHBUGNTLQUAJA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|