C21H20BrFN6O6 — CID 69109301
[4-[2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylamino]-4-oxobutan-2-yl]carbamic acid (PubChem CID 69109301) has the molecular formula C21H20BrFN6O6 and a molecular weight of 551.33 g/mol. Its IUPAC name is [4-[2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylamino]-4-oxobutan-2-yl]carbamic acid.
| Compound Name | [4-[2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylamino]-4-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69109301 |
| Molecular Formula | C21H20BrFN6O6 |
| Molecular Weight | 551.33 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | [4-[2-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethylamino]-4-oxobutan-2-yl]carbamic acid |
| SMILES | CC(CC(=O)NCCOc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1[N+](=O)[O-])NC(=O)O |
| InChI | InChI=1S/C21H20BrFN6O6/c1-11(27-21(31)32)6-19(30)24-4-5-35-18-9-16-13(8-17(18)29(33)34)20(26-10-25-16)28-15-3-2-12(22)7-14(15)23/h2-3,7-11,27H,4-6H2,1H3,(H,24,30)(H,31,32)(H,25,26,28) |
| InChIKey | OXHJSYGUVGKENJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|