C19H17BrFN5O4 — CID 69101001
N-[(2S)-1-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxypropan-2-yl]acetamide (PubChem CID 69101001) has the molecular formula C19H17BrFN5O4 and a molecular weight of 478.28 g/mol. Its IUPAC name is N-[(2S)-1-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxypropan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 69101001 |
| Molecular Formula | C19H17BrFN5O4 |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | N-[(2S)-1-[4-(4-bromo-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxypropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C)COc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17BrFN5O4/c1-10(24-11(2)27)8-30-18-7-16-13(6-17(18)26(28)29)19(23-9-22-16)25-15-4-3-12(20)5-14(15)21/h3-7,9-10H,8H2,1-2H3,(H,24,27)(H,22,23,25)/t10-/m0/s1 |
| InChIKey | DAESVHKTOIDZAT-JTQLQIEISA-N |
| XLogP | 4.09 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|