C16H13BrN4O4 — CID 166086413
N-(5-bromo-2-methoxyphenyl)-7-methoxy-6-nitroquinazolin-4-amine (PubChem CID 166086413) has the molecular formula C16H13BrN4O4 and a molecular weight of 405.21 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-7-methoxy-6-nitroquinazolin-4-amine.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-7-methoxy-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 166086413 |
| Molecular Formula | C16H13BrN4O4 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-7-methoxy-6-nitroquinazolin-4-amine |
| SMILES | COc1ccc(Br)cc1Nc1ncnc2cc(OC)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C16H13BrN4O4/c1-24-14-4-3-9(17)5-12(14)20-16-10-6-13(21(22)23)15(25-2)7-11(10)18-8-19-16/h3-8H,1-2H3,(H,18,19,20) |
| InChIKey | AZVAJIRALPAIJJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|