C33H22Cl2N8O5 — CID 158470412
7-chloro-N-(3-ethynylphenyl)-6-nitroquinazolin-4-amine;N-(3-ethynylphenyl)-7-methoxy-6-nitroquinazolin-4-amine;hydrochloride (PubChem CID 158470412) has the molecular formula C33H22Cl2N8O5 and a molecular weight of 681.50 g/mol. Its IUPAC name is 7-chloro-N-(3-ethynylphenyl)-6-nitroquinazolin-4-amine;N-(3-ethynylphenyl)-7-methoxy-6-nitroquinazolin-4-amine;hydrochloride.
| Compound Name | 7-chloro-N-(3-ethynylphenyl)-6-nitroquinazolin-4-amine;N-(3-ethynylphenyl)-7-methoxy-6-nitroquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 158470412 |
| Molecular Formula | C33H22Cl2N8O5 |
| Molecular Weight | 681.50 g/mol |
| Exact Mass | 680.11 |
| IUPAC Name | 7-chloro-N-(3-ethynylphenyl)-6-nitroquinazolin-4-amine;N-(3-ethynylphenyl)-7-methoxy-6-nitroquinazolin-4-amine;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(Cl)c([N+](=O)[O-])cc23)c1.C#Cc1cccc(Nc2ncnc3cc(OC)c([N+](=O)[O-])cc23)c1.Cl |
| InChI | InChI=1S/C17H12N4O3.C16H9ClN4O2.ClH/c1-3-11-5-4-6-12(7-11)20-17-13-8-15(21(22)23)16(24-2)9-14(13)18-10-19-17;1-2-10-4-3-5-11(6-10)20-16-12-7-15(21(22)23)13(17)8-14(12)18-9-19-16;/h1,4-10H,2H3,(H,18,19,20);1,3-9H,(H,18,19,20);1H |
| InChIKey | HGGWQPDCGPVTBR-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.50 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|