C27H23N5O5 — CID 134487482
N-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-methyl-3-nitrobenzamide (PubChem CID 134487482) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 134487482 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-methyl-3-nitrobenzamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(NC(=O)c4ccc(C)c([N+](=O)[O-])c4)cc23)c1 |
| InChI | InChI=1S/C27H23N5O5/c1-4-18-6-5-7-20(12-18)30-26-21-14-23(25(37-11-10-36-3)15-22(21)28-16-29-26)31-27(33)19-9-8-17(2)24(13-19)32(34)35/h1,5-9,12-16H,10-11H2,2-3H3,(H,31,33)(H,28,29,30) |
| InChIKey | GHOZMRYSDNLBKH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|