C18H14ClN3O2 — CID 18925071
methyl 4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrochloride (PubChem CID 18925071) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is methyl 4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrochloride.
| Compound Name | methyl 4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18925071 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | methyl 4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(C(=O)OC)cc23)c1.Cl |
| InChI | InChI=1S/C18H13N3O2.ClH/c1-3-12-5-4-6-14(9-12)21-17-15-10-13(18(22)23-2)7-8-16(15)19-11-20-17;/h1,4-11H,2H3,(H,19,20,21);1H |
| InChIKey | IDHHMNQZABWRON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|