C18H14ClN3O3 — CID 142773010
methyl 2-chloro-4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrate (PubChem CID 142773010) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is methyl 2-chloro-4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrate.
| Compound Name | methyl 2-chloro-4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrate |
|---|---|
| PubChem CID | 142773010 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | methyl 2-chloro-4-(3-ethynylanilino)quinazoline-6-carboxylate;hydrate |
| SMILES | C#Cc1cccc(Nc2nc(Cl)nc3ccc(C(=O)OC)cc23)c1.O |
| InChI | InChI=1S/C18H12ClN3O2.H2O/c1-3-11-5-4-6-13(9-11)20-16-14-10-12(17(23)24-2)7-8-15(14)21-18(19)22-16;/h1,4-10H,2H3,(H,20,21,22);1H2 |
| InChIKey | KGBCGBJYNXUWDZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|