C19H13ClN4O — CID 141376723
N-[2-chloro-4-(3-ethynylanilino)quinazolin-6-yl]prop-2-enamide (PubChem CID 141376723) has the molecular formula C19H13ClN4O and a molecular weight of 348.79 g/mol. Its IUPAC name is N-[2-chloro-4-(3-ethynylanilino)quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[2-chloro-4-(3-ethynylanilino)quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 141376723 |
| Molecular Formula | C19H13ClN4O |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-[2-chloro-4-(3-ethynylanilino)quinazolin-6-yl]prop-2-enamide |
| SMILES | C#Cc1cccc(Nc2nc(Cl)nc3ccc(NC(=O)C=C)cc23)c1 |
| InChI | InChI=1S/C19H13ClN4O/c1-3-12-6-5-7-13(10-12)22-18-15-11-14(21-17(25)4-2)8-9-16(15)23-19(20)24-18/h1,4-11H,2H2,(H,21,25)(H,22,23,24) |
| InChIKey | LEKGRZPUUXMLPY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|