C30H22N6O2 — CID 58192003
4-N-(2-aminophenyl)-1-N-[4-(3-ethynylanilino)quinazolin-6-yl]benzene-1,4-dicarboxamide (PubChem CID 58192003) has the molecular formula C30H22N6O2 and a molecular weight of 498.55 g/mol. Its IUPAC name is 4-N-(2-aminophenyl)-1-N-[4-(3-ethynylanilino)quinazolin-6-yl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-aminophenyl)-1-N-[4-(3-ethynylanilino)quinazolin-6-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 58192003 |
| Molecular Formula | C30H22N6O2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 4-N-(2-aminophenyl)-1-N-[4-(3-ethynylanilino)quinazolin-6-yl]benzene-1,4-dicarboxamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(NC(=O)c4ccc(C(=O)Nc5ccccc5N)cc4)cc23)c1 |
| InChI | InChI=1S/C30H22N6O2/c1-2-19-6-5-7-22(16-19)34-28-24-17-23(14-15-26(24)32-18-33-28)35-29(37)20-10-12-21(13-11-20)30(38)36-27-9-4-3-8-25(27)31/h1,3-18H,31H2,(H,35,37)(H,36,38)(H,32,33,34) |
| InChIKey | FJXOZMGDPBTRIC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|