C28H20N6O2S — CID 58191988
2-N-(2-aminophenyl)-5-N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2,5-dicarboxamide (PubChem CID 58191988) has the molecular formula C28H20N6O2S and a molecular weight of 504.58 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 58191988 |
| Molecular Formula | C28H20N6O2S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2,5-dicarboxamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(NC(=O)c4ccc(C(=O)Nc5ccccc5N)s4)cc23)c1 |
| InChI | InChI=1S/C28H20N6O2S/c1-2-17-6-5-7-18(14-17)32-26-20-15-19(10-11-22(20)30-16-31-26)33-27(35)24-12-13-25(37-24)28(36)34-23-9-4-3-8-21(23)29/h1,3-16H,29H2,(H,33,35)(H,34,36)(H,30,31,32) |
| InChIKey | WTJDUIBDNRCFPL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|