C25H26N6O — CID 44599964
N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide (PubChem CID 44599964) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide.
| Compound Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide |
|---|---|
| PubChem CID | 44599964 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(NC(=O)CN4CC5CCN(C)C5C4)cc23)c1 |
| InChI | InChI=1S/C25H26N6O/c1-3-17-5-4-6-19(11-17)29-25-21-12-20(7-8-22(21)26-16-27-25)28-24(32)15-31-13-18-9-10-30(2)23(18)14-31/h1,4-8,11-12,16,18,23H,9-10,13-15H2,2H3,(H,28,32)(H,26,27,29) |
| InChIKey | DAOLXCVJPJJZJH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|