C24H26N6O2 — CID 59142757
N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 59142757) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 59142757 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC(=O)CN4CCN(C)CC4)cc23)c1 |
| InChI | InChI=1S/C24H26N6O2/c1-4-17-6-5-7-18(12-17)27-24-19-13-21(22(32-3)14-20(19)25-16-26-24)28-23(31)15-30-10-8-29(2)9-11-30/h1,5-7,12-14,16H,8-11,15H2,2-3H3,(H,28,31)(H,25,26,27) |
| InChIKey | IMPGTQJWQXEMPX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|