C25H28N4O3 — CID 150282536
N-(3-ethynylphenyl)-7-methoxy-6-[1-(2-methoxyethyl)piperidin-4-yl]oxyquinazolin-4-amine (PubChem CID 150282536) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-7-methoxy-6-[1-(2-methoxyethyl)piperidin-4-yl]oxyquinazolin-4-amine.
| Compound Name | N-(3-ethynylphenyl)-7-methoxy-6-[1-(2-methoxyethyl)piperidin-4-yl]oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 150282536 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-(3-ethynylphenyl)-7-methoxy-6-[1-(2-methoxyethyl)piperidin-4-yl]oxyquinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OC4CCN(CCOC)CC4)cc23)c1 |
| InChI | InChI=1S/C25H28N4O3/c1-4-18-6-5-7-19(14-18)28-25-21-15-24(23(31-3)16-22(21)26-17-27-25)32-20-8-10-29(11-9-20)12-13-30-2/h1,5-7,14-17,20H,8-13H2,2-3H3,(H,26,27,28) |
| InChIKey | GFWYELDSCRJZQY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|