C27H29N5O3 — CID 59382730
N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[1-(2-methoxyethyl)piperidin-4-ylidene]acetamide (PubChem CID 59382730) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[1-(2-methoxyethyl)piperidin-4-ylidene]acetamide.
| Compound Name | N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[1-(2-methoxyethyl)piperidin-4-ylidene]acetamide |
|---|---|
| PubChem CID | 59382730 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[1-(2-methoxyethyl)piperidin-4-ylidene]acetamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC(=O)C=C4CCN(CCOC)CC4)cc23)c1 |
| InChI | InChI=1S/C27H29N5O3/c1-4-19-6-5-7-21(14-19)30-27-22-16-24(25(35-3)17-23(22)28-18-29-27)31-26(33)15-20-8-10-32(11-9-20)12-13-34-2/h1,5-7,14-18H,8-13H2,2-3H3,(H,31,33)(H,28,29,30) |
| InChIKey | UWOXUJDTPOSXAY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|