C23H23N5O2 — CID 44600598
N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperidine-1-carboxamide (PubChem CID 44600598) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperidine-1-carboxamide.
| Compound Name | N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 44600598 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperidine-1-carboxamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC(=O)N4CCCCC4)cc23)c1 |
| InChI | InChI=1S/C23H23N5O2/c1-3-16-8-7-9-17(12-16)26-22-18-13-20(21(30-2)14-19(18)24-15-25-22)27-23(29)28-10-5-4-6-11-28/h1,7-9,12-15H,4-6,10-11H2,2H3,(H,27,29)(H,24,25,26) |
| InChIKey | NDNMTNPXKBFDJK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|