C25H26N4O4 — CID 58896691
methyl 4-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]oxypiperidine-1-carboxylate (PubChem CID 58896691) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is methyl 4-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]oxypiperidine-1-carboxylate.
| Compound Name | methyl 4-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58896691 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | methyl 4-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]oxypiperidine-1-carboxylate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCC)c(OC4CCN(C(=O)OC)CC4)cc23)c1 |
| InChI | InChI=1S/C25H26N4O4/c1-4-17-7-6-8-18(13-17)28-24-20-14-23(22(32-5-2)15-21(20)26-16-27-24)33-19-9-11-29(12-10-19)25(30)31-3/h1,6-8,13-16,19H,5,9-12H2,2-3H3,(H,26,27,28) |
| InChIKey | ZCADWIKHZQMZCP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|